Loading distributor info...
| Description | cGAMP (Cyclic GMP-AMP; 3',3'-cGAMP) is an endogenous second messenger in metazoans and triggers interferon production in response to cytosolic DNA; STING ligand. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A21890 |
|---|---|
| Formula | C20H24N10O13P2 |
| Molecular Weight | 674.41 |
| CAS Number | 849214-04-6 |
| SMILES | O=P(O[C@H]1[C@@H](O)[C@H](N2C=NC3=C2N=CN=C3N)O[C@@H]1COP4(O)=O)(O)OC[C@@H]5[C@@H](O4)[C@@H](O)[C@H](N6C=NC7=C6N=C(N)NC7=O)O5 |
| Synonyms | Cyclic GMP-AMP; 3',3'-cGAMP |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 17 mg/mL (25.28 mM) | |
| Water | 86 mg/mL (127.9 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.83 mL | 74.14 mL | 148.28 mL |
| 0.5 mM | 2.97 mL | 14.83 mL | 29.66 mL |
| 1 mM | 1.48 mL | 7.41 mL | 14.83 mL |
| 5 mM | 0.3 mL | 1.48 mL | 2.97 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
