Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | CID755673 is a potent PKD inhibitor with IC50s of 182 nM, 280 nM and 227 nM for PKD1, PKD2 and PKD3, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13804 |
|---|---|
| Formula | C12H11NO3 |
| Molecular Weight | 217.22 |
| CAS Number | 521937-07-5 |
| SMILES | C1CC2=C(C(=O)NC1)OC3=C2C=C(C=C3)O |
| Synonyms | CID755673, CID-755673 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 43 mg/mL (197.95 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2%DMSO+30%peg300+2%t-80+ddaH2O | 5 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.04 mL | 230.18 mL | 460.36 mL |
| 0.5 mM | 9.21 mL | 46.04 mL | 92.07 mL |
| 1 mM | 4.6 mL | 23.02 mL | 46.04 mL |
| 5 mM | 0.92 mL | 4.6 mL | 9.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
