Loading distributor info...
| Description | CIGB-300 is a pro-apoptotic peptide that targets casein kinase 2 (CK2). It exhibits potent anticancer activity by disrupting CK2 phosphorylation, leading to apoptosis in various tumor cell lines. This compound is valuable for cancer research, particularly in studies focused on apoptosis and CK2 modulation. |
|---|
| Catalog Num | A32991 |
|---|---|
| Formula | C127H215N53O30S3 |
| Molecular Weight | 3060.60 |
| CAS Number | 1072877-99-6 |
| Sequence | Gly-Arg-Lys-Lys-Arg-Arg-Gln-Arg-Arg-Arg-Pro-Pro-Gln-{βAla}-Cys-Trp-Met-Ser-Pro-Arg-His-Leu-Gly-Thr-Cys (Disulfide bridge: Cys15-Cys25) |
| Sequence shortening | GRKKRRQRRRPPQ-{βAla}-CWMSPRHLGTC (Disulfide bridge: Cys15-Cys25) |
| SMILES | C(C=1C=2C(NC1)=CC=CC2)[C@H]3C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N4[C@](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC5=CN=CN5)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@]([C@@H](C)O)(C(=O)N[C@H](C(O)=O)CSSC[C@H](NC(CCNC([C@@H](NC(=O)[C@H]6N(C(=O)[C@H]7N(C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CCCNC(=N)N)NC(CN)=O)=O)CCCCN)=O)CCCCN)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCC(N)=O)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CCC7)CCC6)CCC(N)=O)=O)=O)C(=O)N3)[H])(CCC4)[H] |
| Synonyms | P15-Tat |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
