Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cinchonidine is an alkaloid used in asymmetric synthesis in organic chemistry. It is a stereoisomer and pseudo-enantiomer of cinchonine. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10220 |
|---|---|
| Formula | C19H22N2O |
| Molecular Weight | 294.4 |
| CAS Number | 485-71-2 |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](C3=CC=NC4=CC=CC=C34)O |
| Synonyms | L-Cinchonidine, alpha-Quinidine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (173.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 51 mg/mL (173.24 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.97 mL | 169.84 mL | 339.67 mL |
| 0.5 mM | 6.79 mL | 33.97 mL | 67.93 mL |
| 1 mM | 3.4 mL | 16.98 mL | 33.97 mL |
| 5 mM | 0.68 mL | 3.4 mL | 6.79 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
