Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cinnarizine is a medication derivative of piperazine, and characterized as an antihistamine and a calcium channel blocker. |
|---|
| Catalog Num | A16455 |
|---|---|
| Formula | C26H28N2 |
| Molecular Weight | 368.51 |
| CAS Number | 298-57-7 |
| SMILES | C1(/C=C/CN2CCN(C(C3=CC=CC=C3)C4=CC=CC=C4)CC2)=CC=CC=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (187.24 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.14 mL | 135.68 mL | 271.36 mL |
| 0.5 mM | 5.43 mL | 27.14 mL | 54.27 mL |
| 1 mM | 2.71 mL | 13.57 mL | 27.14 mL |
| 5 mM | 0.54 mL | 2.71 mL | 5.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
