Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Clioquinol is an orally bioavailable, lipophilic, copper-binding, halogenated 8-hydroxyquinoline with antifungal, antiparasitic and potential antitumor activities. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16461 |
|---|---|
| Formula | C9H5ClINO |
| Molecular Weight | 305.5 |
| CAS Number | 130-26-7 |
| SMILES | C1=CC2=C(C(=C(C=C2Cl)I)O)N=C1 |
| Synonyms | Iodochlorhydroxyquin, Chinoform |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (193.12 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (3.27 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.73 mL | 163.67 mL | 327.33 mL |
| 0.5 mM | 6.55 mL | 32.73 mL | 65.47 mL |
| 1 mM | 3.27 mL | 16.37 mL | 32.73 mL |
| 5 mM | 0.65 mL | 3.27 mL | 6.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
