Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Clofarabine is a second generation purine nucleoside analog with antineoplastic activity | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10228 |
|---|---|
| Formula | C10H11ClFN5O3 |
| Molecular Weight | 303.7 |
| CAS Number | 123318-82-1 |
| SMILES | C1=NC2=C(N1[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)F)N=C(N=C2N)Cl |
| Synonyms | Clolar, Evoltra |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 55 mg/mL (181.11 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300 +1% Tween 80+ddH2O | 7 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.93 mL | 164.64 mL | 329.27 mL |
| 0.5 mM | 6.59 mL | 32.93 mL | 65.85 mL |
| 1 mM | 3.29 mL | 16.46 mL | 32.93 mL |
| 5 mM | 0.66 mL | 3.29 mL | 6.59 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
