Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Closantel is a gram positive antibacterial activity inhibitor, inhibiting the KinA/Spo0F system with IC50 of 3.8 μM. |
|---|
| Catalog Num | A16467 |
|---|---|
| Formula | C22H13Cl2I2N2O2.Na |
| Molecular Weight | 685.06 |
| CAS Number | 61438-64-0 |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=CC(=CC(=C2[O-])I)I)Cl)C(C#N)C3=CC=C(C=C3)Cl.[Na+] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (126.99 mM) | |
| Water | Insoluble | ||
| Ethanol | 87 mg/mL (126.99 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.6 mL | 72.99 mL | 145.97 mL |
| 0.5 mM | 2.92 mL | 14.6 mL | 29.19 mL |
| 1 mM | 1.46 mL | 7.3 mL | 14.6 mL |
| 5 mM | 0.29 mL | 1.46 mL | 2.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
