Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Closantel is a gram positive antibacterial activity inhibitor, inhibiting the KinA/Spo0F system with IC50 of 3.8 μM. |
|---|
| Catalog Num | A16466 |
|---|---|
| Formula | C22H14Cl2I2N2O2 |
| Molecular Weight | 663.07 |
| CAS Number | 57808-65-8 |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=CC(=CC(=C2O)I)I)Cl)C(C#N)C3=CC=C(C=C3)Cl |
| Synonyms | R-31520 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (138.75 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.08 mL | 75.41 mL | 150.81 mL |
| 0.5 mM | 3.02 mL | 15.08 mL | 30.16 mL |
| 1 mM | 1.51 mL | 7.54 mL | 15.08 mL |
| 5 mM | 0.3 mL | 1.51 mL | 3.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
