Loading distributor info...
| Description | CM-4620 is a calcium-release activated calcium-channel (CRAC) inhibitor, with IC50s of 119, 895 nM for Orai1/STIM1 and Orai2/STIM1 channels, respectively. |
|---|
| Catalog Num | A19452 |
|---|---|
| Formula | C19H11ClF3N3O3 |
| Molecular Weight | 421.76 |
| CAS Number | 1713240-67-5 |
| SMILES | O=C(NC1=NC=C(C2=C(Cl)C=C(OC(F)(F)O3)C3=C2)N=C1)C4=C(C)C=CC=C4F |
| Synonyms | CM4620, CM 4620 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (218.13 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.71 mL | 118.55 mL | 237.1 mL |
| 0.5 mM | 4.74 mL | 23.71 mL | 47.42 mL |
| 1 mM | 2.37 mL | 11.86 mL | 23.71 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.74 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
