Loading distributor info...
| Description | Combretastatin A4 is an antitumor, antiangiogenic and antimetastatic agent, in vitro and in vivo. Combretastatin A4 is a microtubule-targeting agent that binds β-tubulin with Kd of 0.4 μM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12601 |
|---|---|
| Formula | C18H20O5 |
| Molecular Weight | 316.35 |
| CAS Number | 117048-59-6 |
| SMILES | COC1=C(C=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC)O |
| Synonyms | CRC 87-09, NSC 817373 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 58 mg/mL (183.34 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 31 mg/mL (97.99 mM) | ||
| In vivo | 5% DMSO+50% PEG 300+ddH2O | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.61 mL | 158.05 mL | 316.11 mL |
| 0.5 mM | 6.32 mL | 31.61 mL | 63.22 mL |
| 1 mM | 3.16 mL | 15.81 mL | 31.61 mL |
| 5 mM | 0.63 mL | 3.16 mL | 6.32 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
