Loading distributor info...
| Description | CORM-3 is a water-soluble carbon monoxide-releasing molecule with anti-inflammatory and cardioprotective activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14285 |
|---|---|
| Formula | C5H4ClNO5Ru |
| Molecular Weight | 294.61 |
| CAS Number | 475473-26-8 |
| SMILES | O=C1[O-][Ru+2]([Cl-])([C]=O)([C]=O)([C]=O)[NH2]C1 |
| Synonyms | CORM3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (125.59 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.94 mL | 169.72 mL | 339.43 mL |
| 0.5 mM | 6.79 mL | 33.94 mL | 67.89 mL |
| 1 mM | 3.39 mL | 16.97 mL | 33.94 mL |
| 5 mM | 0.68 mL | 3.39 mL | 6.79 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
