Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CPI-613 is a racemic mixture of the enantiomers of a synthetic alpha-lipoic lipoic acid analogue with potential chemopreventive and antineoplastic activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11786 |
|---|---|
| Formula | C22H28O2S2 |
| Molecular Weight | 388.6 |
| CAS Number | 95809-78-2 |
| SMILES | C1=CC=C(C=C1)CSCCC(CCCCC(=O)O)SCC2=CC=CC=C2 |
| Synonyms | CPI613 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 74 mg/mL (190.43 mM) | |
| Water | Insoluble | ||
| Ethanol | 74 mg/mL (190.43 mM) | ||
| In vivo | 2% DMSO+corn oil | 13 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.73 mL | 128.67 mL | 257.33 mL |
| 0.5 mM | 5.15 mL | 25.73 mL | 51.47 mL |
| 1 mM | 2.57 mL | 12.87 mL | 25.73 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
