Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aurora kinase/VEGFR 2 inhibitor CYC116 inhibits Aurora kinases A and B and vascular endothelial growth factor receptor 2 (VEGFR2), resulting in disruption of the cell cycle, rapid cell death, and the inhibition of angiogenesis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10248 |
|---|---|
| Formula | C18H20N6OS |
| Molecular Weight | 368.5 |
| CAS Number | 693228-63-6 |
| SMILES | CC1=C(SC(=N1)N)C2=NC(=NC=C2)NC3=CC=C(C=C3)N4CCOCC4 |
| Synonyms | CYC-116 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 24 mg/mL (65.13 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.14 mL | 135.69 mL | 271.37 mL |
| 0.5 mM | 5.43 mL | 27.14 mL | 54.27 mL |
| 1 mM | 2.71 mL | 13.57 mL | 27.14 mL |
| 5 mM | 0.54 mL | 2.71 mL | 5.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
