Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sodium D-Pantothenate is a vitamin that performs an important role in the oxidation of fats and carbohydrates and certain amino acids. It is also a precursor in the biosynthesis of coenzyme A. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17682 |
|---|---|
| Formula | C9H16NNaO5 |
| Molecular Weight | 241.21 |
| CAS Number | 867-81-2 |
| SMILES | O=C(CCNC([C@H](C(C)(CO)C)O)=O)O[Na] |
| Synonyms | Sodium D-Pantothenate; Sodium D Pantothenate; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (24.87 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.46 mL | 207.29 mL | 414.58 mL |
| 0.5 mM | 8.29 mL | 41.46 mL | 82.92 mL |
| 1 mM | 4.15 mL | 20.73 mL | 41.46 mL |
| 5 mM | 0.83 mL | 4.15 mL | 8.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
