Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | D8-MMAE (D8-Monomethyl auristatin E) is a deuterated labeled MMAE, a potent mitotic inhibitor and a tubulin inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21709 |
|---|---|
| Formula | C39H59D8N5O7 |
| Molecular Weight | 726.03 |
| CAS Number | 2070009-72-0 |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(N1[C@@H](CCC1)[C@@H]([C@@H](C)C(N[C@H](C)[C@@H](O)C2=CC=CC=C2)=O)OC)=O)OC)N(C([C@@](C(C([2H])([2H])[2H])(C([2H])([2H])[2H])[2H])([2H])NC([C@H](C(C)C)NC)=O)=O)C |
| Synonyms | D8-Monomethyl auristatin E |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
