Dalbavancin HCl
Catalog No.: A15948
Dalbavancin is a novel second-generation lipoglycopeptide antibiotic.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Dalbavancin is a novel second-generation lipoglycopeptide antibiotic. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15948 |
|---|---|
| Formula | C88H101Cl3N10O28 |
| Molecular Weight | 1853.17 |
| CAS Number | 2227366-51-8 |
| SMILES | CC(CCCCCCCCC(N[C@@H]1[C@@H](O)[C@H](O)[C@@H](C(O)=O)O[C@H]1OC2=C3C=C4C=C2OC5=C(Cl)C=C([C@@H](O)[C@H]6C(N[C@H](C(NCCCN(C)C)=O)C7=CC(O)=CC(O[C@@H]8[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O8)=C7C9=C(O)C=CC([C@@H](NC([C@@H]4NC([C@@H]%10C%11=CC(OC%12=C(O)C=CC([C@@H](NC)C(N[C@@H](C(N%10)=O)CC%13=CC=C(C=C%13)O3)=O)=C%12)=CC(O)=C%11Cl)=O)=O)C(N6)=O)=C9)=O)C=C5)=O)C.Cl |
| Synonyms | A-A 1, BI397, VER001, MDL63397 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (54.49 mM) | |
| Water | 99 mg/mL (54.49 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 5.4 mL | 26.98 mL | 53.96 mL |
| 0.5 mM | 1.08 mL | 5.4 mL | 10.79 mL |
| 1 mM | 0.54 mL | 2.7 mL | 5.4 mL |
| 5 mM | 0.11 mL | 0.54 mL | 1.08 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2