Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | dBET1 is a potent BRD4 protein degrader based on PROTAC technology with an EC50 of 430 nM. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A16858 |
|---|---|
| Formula | C38H37ClN8O7S |
| Molecular Weight | 785.27 |
| CAS Number | 1799711-21-9 |
| SMILES | O=C(NCCCCNC(COC1=CC=CC(C(N2C(CC3)C(NC3=O)=O)=O)=C1C2=O)=O)C[C@H]4C5=NN=C(C)N5C6=C(C(C)=C(C)S6)C(C7=CC=C(Cl)C=C7)=N4 |
| Synonyms | dBET-1, dBET 1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (113.33 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 35 mg/mL (44.57 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 12.73 mL | 63.67 mL | 127.34 mL |
| 0.5 mM | 2.55 mL | 12.73 mL | 25.47 mL |
| 1 mM | 1.27 mL | 6.37 mL | 12.73 mL |
| 5 mM | 0.25 mL | 1.27 mL | 2.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
