Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Decernotinib is an oral, selective Janus kinase 3 (JAK3) inhibitor being developed by Vertex. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14012 |
|---|---|
| Formula | C18H19F3N6O |
| Molecular Weight | 392.38 |
| CAS Number | 944842-54-0 |
| SMILES | CC[C@](C)(C(=O)NCC(F)(F)F)NC1=NC(=NC=C1)C2=CNC3=C2C=CC=N3 |
| Synonyms | VX-509, VX509, VX 509, VRT-831509, VRT831509, VRT 831509 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (178.39 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 18 mg/mL (45.87 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.49 mL | 127.43 mL | 254.85 mL |
| 0.5 mM | 5.1 mL | 25.49 mL | 50.97 mL |
| 1 mM | 2.55 mL | 12.74 mL | 25.49 mL |
| 5 mM | 0.51 mL | 2.55 mL | 5.1 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
