Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Diaveridine (EGIS-5645) is a dihydrofolate reductase (DHFR) inhibitor with a Ki of 11.5 nM for the wild type DHFR and also an antibacterial agent. |
|---|
| Catalog Num | A17000 |
|---|---|
| Formula | C13H16N4O2 |
| Molecular Weight | 260.29 |
| CAS Number | 5355-16-8 |
| SMILES | NC1=NC=C(CC2=CC=C(OC)C(OC)=C2)C(N)=N1 |
| Synonyms | EGIS-5645, EGIS5645, EGIS 5645 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 22 mg/mL (84.52 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.42 mL | 192.09 mL | 384.19 mL |
| 0.5 mM | 7.68 mL | 38.42 mL | 76.84 mL |
| 1 mM | 3.84 mL | 19.21 mL | 38.42 mL |
| 5 mM | 0.77 mL | 3.84 mL | 7.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
