Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dinaciclib (SCH 727965) is a potent and selective cyclin-dependent kinase (CDK) inhibitor, selectively inhibiting CDK1, CDK2, CDK5 and CDK9 with IC50 values of 3, 1, 1 and 4 nM respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11129 |
|---|---|
| Formula | C21H28N6O2 |
| Molecular Weight | 396.5 |
| CAS Number | 779353-01-4 |
| SMILES | CCC1=C2N=C(C=C(N2N=C1)NCC3=C[N+](=CC=C3)[O-])N4CCCC[C@H]4CCO |
| Synonyms | SCH727965, SCH-727965 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 22 mg/mL (55.48 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 7 mg/mL (17.65 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.22 mL | 126.1 mL | 252.21 mL |
| 0.5 mM | 5.04 mL | 25.22 mL | 50.44 mL |
| 1 mM | 2.52 mL | 12.61 mL | 25.22 mL |
| 5 mM | 0.5 mL | 2.52 mL | 5.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
