Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Diphemanil methylsulfate is a quaternary ammonium anticholinergic. |
|---|
| Catalog Num | A16513 |
|---|---|
| Formula | C21H27NO4S |
| Molecular Weight | 389.51 |
| CAS Number | 62-97-5 |
| SMILES | [O-]S(=O)(OC)=O.C[N+]1(C)CC/C(CC1)=C(C2=CC=CC=C2)\C3=CC=CC=C3 |
| Synonyms | Diphemanil mesylate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 23 mg/mL (59.05 mM) | |
| Water | 26 mg/mL (66.75 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.67 mL | 128.37 mL | 256.73 mL |
| 0.5 mM | 5.13 mL | 25.67 mL | 51.35 mL |
| 1 mM | 2.57 mL | 12.84 mL | 25.67 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
