Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Doxazosin mesylate, a quinazoline compound, is an α1-selective alpha blocker used to treat high blood pressure and urinary retention associated with benign prostatic hyperplasia (BPH). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10334 |
|---|---|
| Formula | C23H25N5O5.CH3SO3H;C24H29N5O8S |
| Molecular Weight | 547.58 |
| CAS Number | 77883-43-3 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C(=O)C4COC5=CC=CC=C5O4)N)OC.CS(=O)(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 14 mg/mL (25.56 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.26 mL | 91.31 mL | 182.62 mL |
| 0.5 mM | 3.65 mL | 18.26 mL | 36.52 mL |
| 1 mM | 1.83 mL | 9.13 mL | 18.26 mL |
| 5 mM | 0.37 mL | 1.83 mL | 3.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
