Loading distributor info...
| Description | E7046 is an orally bioavailable and specific EP4 antagonist, with IC50 of 13.5 nM and Ki of 23.14 nM, exhibiting anti-tumor activities. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A19711 |
|---|---|
| Formula | C22H18F5N3O4 |
| Molecular Weight | 483.39 |
| CAS Number | 1369489-71-3 |
| SMILES | O=C(O)C1=CC=C([C@@H](NC(C2=C(OC3=CC=CC(C(F)(F)F)=C3)N(C)N=C2C(F)F)=O)C)C=C1 |
| Synonyms | E-7046; E 7046 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (186.18 mM) | |
| Ethanol | <1 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.69 mL | 103.44 mL | 206.87 mL |
| 0.5 mM | 4.14 mL | 20.69 mL | 41.37 mL |
| 1 mM | 2.07 mL | 10.34 mL | 20.69 mL |
| 5 mM | 0.41 mL | 2.07 mL | 4.14 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
