Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Edoxaban is a selective factor Xa inhibitor with Ki of 0.561 nM | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14317 |
|---|---|
| Formula | C24H30ClN7O4S.C7H8O3S.H2O |
| Molecular Weight | 738.27 |
| CAS Number | 1229194-11-9 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CN1CCC2=C(C1)SC(=N2)C(=O)N[C@@H]3C[C@H](CC[C@@H]3NC(=O)C(=O)NC4=NC=C(C=C4)Cl)C(=O)N(C)C.O |
| Synonyms | DU-176b |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (120.55 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 13.55 mL | 67.73 mL | 135.45 mL |
| 0.5 mM | 2.71 mL | 13.55 mL | 27.09 mL |
| 1 mM | 1.35 mL | 6.77 mL | 13.55 mL |
| 5 mM | 0.27 mL | 1.35 mL | 2.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
