Loading distributor info...
| Description | Edrophonium Chloride, also known as Tensilon, is an acetylcholinesterase inhibitor used in cardiac arrhythmias and in the diagnosis of myasthenia gravis. Edrophonium Chloride has also been used as an antidote to curare principles. |
|---|
| Catalog Num | A17794 |
|---|---|
| Formula | C10H16ClNO |
| Molecular Weight | 201.69 |
| CAS Number | 116-38-1 |
| SMILES | C[N+](C)(CC)C1=CC=CC(O)=C1.[Cl-] |
| Synonyms | Edrophonium Chloride; Tensilon; Tensilon chloride; Antirex; Enlon; Reversol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 36 mg/mL (178.49 mM) | |
| Water | 36 mg/mL (178.49 mM) | ||
| Ethanol | 9 mg/mL (44.62 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 49.58 mL | 247.91 mL | 495.81 mL |
| 0.5 mM | 9.92 mL | 49.58 mL | 99.16 mL |
| 1 mM | 4.96 mL | 24.79 mL | 49.58 mL |
| 5 mM | 0.99 mL | 4.96 mL | 9.92 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
