Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EOAI3402143 is a deubiquitinase (DUB) inhibitor, which inhibits dose-dependently inhibits Usp9x/Usp24 and Usp5. |
|---|
| Catalog Num | A20166 |
|---|---|
| Formula | C25H28Cl2N4O3 |
| Molecular Weight | 503.42 |
| CAS Number | 1699750-95-2 |
| SMILES | ClC1=C(/C=C(C(NC(CCC)C2=CC=C(OCCN3CCOCC3)C=C2)=O)\C#N)N=C(Cl)C=C1.[E] |
| Synonyms | EOAI 3402143, EOAI-3402143 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (172.82 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.86 mL | 99.32 mL | 198.64 mL |
| 0.5 mM | 3.97 mL | 19.86 mL | 39.73 mL |
| 1 mM | 1.99 mL | 9.93 mL | 19.86 mL |
| 5 mM | 0.4 mL | 1.99 mL | 3.97 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
