Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Epoxomicin is a potent anti-tumor agent isolated from Actinomycetes that is used as a selective and irreversible inhibitor of the 20S proteasome. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12730 |
|---|---|
| Formula | C28H50N4O7 |
| Molecular Weight | 554.7 |
| CAS Number | 134381-21-8 |
| SMILES | CC[C@H](C)[C@@H](NC(=O)[C@H]([C@@H](C)CC)N(C)C(=O)C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@H](CC(C)C)C(=O)[C@]1(C)OC1 |
| Synonyms | BU-4061T |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (176.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 98 mg/mL (176.66 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.03 mL | 90.14 mL | 180.28 mL |
| 0.5 mM | 3.61 mL | 18.03 mL | 36.06 mL |
| 1 mM | 1.8 mL | 9.01 mL | 18.03 mL |
| 5 mM | 0.36 mL | 1.8 mL | 3.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
