Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | ESI-09 is a specific exchange protein directly activated by cAMP (EPAC) inhibitor with IC50 of 3.2 uM and 1.4 uM for EPAC1 and EPAC2, | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A14233 |
|---|---|
| Formula | C16H15ClN4O2 |
| Molecular Weight | 330.77 |
| CAS Number | 263707-16-0 |
| SMILES | CC(C)(C)C1=CC(=NO1)C(=O)/C(=N/NC2=CC(=CC=C2)Cl)/C#N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 63 mg/mL (190.46 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 19 mg/mL (57.44 mM) | ||
| In vivo | 10% ethanol+10% Tween 80+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.23 mL | 151.16 mL | 302.32 mL |
| 0.5 mM | 6.05 mL | 30.23 mL | 60.46 mL |
| 1 mM | 3.02 mL | 15.12 mL | 30.23 mL |
| 5 mM | 0.6 mL | 3.02 mL | 6.05 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
