Loading distributor info...
| Description | Estramustine phosphate sodium is an antimicrotubule chemotherapy agent; arrests prostate cancer cells in the G2/M phase of the cell cycle. |
|---|
| Catalog Num | A18036 |
|---|---|
| Formula | C23H30Cl2NNa2O6P |
| Molecular Weight | 564.35 |
| CAS Number | 52205-73-9 |
| SMILES | [O-]P([O-])(O[C@H]1CC[C@@]2([H])[C@@]3([H])[C@](C(C=CC(OC(N(CCCl)CCCl)=O)=C4)=C4CC3)([H])CC[C@@]21C)=O.[Na+].[Na+] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 89 mg/mL (157.7 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.72 mL | 88.6 mL | 177.2 mL |
| 0.5 mM | 3.54 mL | 17.72 mL | 35.44 mL |
| 1 mM | 1.77 mL | 8.86 mL | 17.72 mL |
| 5 mM | 0.35 mL | 1.77 mL | 3.54 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
