Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Ethopabate is a folate metabolism inhibitor used in the prophylaxis and treatment of coccidiosis in chickens. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17296 |
|---|---|
| Formula | C12H15NO4 |
| Molecular Weight | 237.255 |
| CAS Number | CAS: 59-06-3 |
| SMILES | O=C(OC)C1=CC=C(NC(C)=O)C=C1OCC |
| Synonyms | Ethopabate, Amprol Plus, Ethopabat, UNII-F4X3L6068O, UNII F4X3L6068O, UNIIF4X3L6068O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (185.46 mM) | |
| Water | Insoluble | ||
| Ethanol | 44 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.15 mL | 210.74 mL | 421.49 mL |
| 0.5 mM | 8.43 mL | 42.15 mL | 84.3 mL |
| 1 mM | 4.21 mL | 21.07 mL | 42.15 mL |
| 5 mM | 0.84 mL | 4.21 mL | 8.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
