Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EX229 (compound 991) is a potent AMPK activator that is 5-10-fold more potent than A769662 in activating AMPK. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16795 |
|---|---|
| Formula | C24H18ClN3O3 |
| Molecular Weight | 431.87 |
| CAS Number | 1219739-36-2 |
| SMILES | CC1=C(C=C(C=C1)OC2=NC3=C(N2)C=C(C(=C3)C4=CC5=C(C=C4)N(C=C5)C)Cl)C(=O)O |
| Synonyms | ex-229, ex 229 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 11 mg/mL (25.47 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.16 mL | 115.78 mL | 231.55 mL |
| 0.5 mM | 4.63 mL | 23.16 mL | 46.31 mL |
| 1 mM | 2.32 mL | 11.58 mL | 23.16 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
