Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Floxuridine is an oncology drug that belongs to the class known as antimetabolites. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10392 |
|---|---|
| Formula | C9H11FN2O5 |
| Molecular Weight | 246.2 |
| CAS Number | 50-91-9 |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)F)CO)O |
| Synonyms | 5-fluorodeoxyuridine, Fluorodeoxyuridine, FUDR, FdUrd, Floxuridin, FAMP |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (174.66 mM) | |
| Water | 43 mg/mL (174.66 mM) | ||
| Ethanol | 9 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.62 mL | 203.09 mL | 406.17 mL |
| 0.5 mM | 8.12 mL | 40.62 mL | 81.23 mL |
| 1 mM | 4.06 mL | 20.31 mL | 40.62 mL |
| 5 mM | 0.81 mL | 4.06 mL | 8.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
