Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | FM-381 is a JAK3 specific reversible covalent inhibitor with IC50 of 127 pM for JAK3 and demonstrates 400-, 2,700- and 3,600-fold selectivity over JAK1, JAK2, and TYK2, respectively. |
|---|
| Catalog Num | A16805 |
|---|---|
| Formula | C24H24N6O2 |
| Molecular Weight | 428.496 |
| CAS Number | 2226521-65-7 |
| SMILES | O=C(N(C)C)/C(C#N)=C/C(O1)=CC=C1C2=NC3=CN=C(NC=C4)C4=C3N2C5CCCCC5 |
| Synonyms | FM 381, FM381 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 20 mg/mL (46.67 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (4.66 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.34 mL | 116.69 mL | 233.37 mL |
| 0.5 mM | 4.67 mL | 23.34 mL | 46.67 mL |
| 1 mM | 2.33 mL | 11.67 mL | 23.34 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
