Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | GM 6001 is a potent, reversible broad spectrum inhibitor of zinc-containing proteases, including matrix metalloproteinases (MMPs). | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A13320 |
|---|---|
| Formula | C20H28N4O4 |
| Molecular Weight | 388.5 |
| CAS Number | 142880-36-2 |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)NC |
| Synonyms | Galardin, Ilomastat, GM-6001 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 73 mg/mL (187.92 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 7 mg/mL (18.02 mM) | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 10 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.74 mL | 128.7 mL | 257.4 mL |
| 0.5 mM | 5.15 mL | 25.74 mL | 51.48 mL |
| 1 mM | 2.57 mL | 12.87 mL | 25.74 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
