Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Goserelin is a synthetic decapeptide analog of luteinizing hormone-releasing hormone (LHRH) with antineoplastic activity. |
|---|
| Catalog Num | A15959 |
|---|---|
| Formula | C61H88N18O16 |
| Molecular Weight | 1329.49 |
| CAS Number | 145781-92-6 |
| SMILES | OC(C)=O.NC(NCCC[C@H](NC([C@@H](NC([C@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC1=CNC=N1)NC([C@@H]2CCC(N2)=O)=O)=O)CC3=CNC4=C3C=CC=C4)=O)CO)=O)CC5=CC=C(C=C5)O)=O)COC(C)(C)C)=O)CC(C)C)=O)C(N6CCC[C@H]6C(NNC(N)=O)=O)=O)=N |
| Synonyms | ICI118630, ICI-118630, ICI 118630 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | |||
| Water | 99 mg/mL (74.46 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 7.52 mL | 37.61 mL | 75.22 mL |
| 0.5 mM | 1.5 mL | 7.52 mL | 15.04 mL |
| 1 mM | 0.75 mL | 3.76 mL | 7.52 mL |
| 5 mM | 0.15 mL | 0.75 mL | 1.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
