Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK 2830371 is a highly selective Wip1 phosphatase inhibitor with IC50 of 6 nM. |
|---|
| Catalog Num | A16565 |
|---|---|
| Formula | C23H29ClN4O2S |
| Molecular Weight | 461.02 |
| CAS Number | 1404456-53-6 |
| SMILES | ClC1=CN=C(C)C(NCC2=CC=C(C(N[C@@H](CC3CCCC3)C(NC4CC4)=O)=O)S2)=C1 |
| Synonyms | GSK-2830371, GSK2830371 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 84 mg/mL (182.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 84 mg/mL (182.2 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+dd H2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.69 mL | 108.46 mL | 216.91 mL |
| 0.5 mM | 4.34 mL | 21.69 mL | 43.38 mL |
| 1 mM | 2.17 mL | 10.85 mL | 21.69 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
