Loading distributor info...
| Description | Guanfacine hydrochloride, an anti-hypertensive agent, is a selective α2A-adrenoceptor agonist with Kd of 31 nM and displays 60-fold selectivity over α2B-adrenoceptors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15098 |
|---|---|
| Formula | C9H10Cl3N3O |
| Molecular Weight | 282.55 |
| CAS Number | 29110-48-3 |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)N=C(N)N)Cl.Cl |
| Synonyms | Guanfacine, Tenex, Intuniv |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (169.88 mM) | |
| Water | 26 mg/mL (92.01 mM) | ||
| Ethanol | 48 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.39 mL | 176.96 mL | 353.92 mL |
| 0.5 mM | 7.08 mL | 35.39 mL | 70.78 mL |
| 1 mM | 3.54 mL | 17.7 mL | 35.39 mL |
| 5 mM | 0.71 mL | 3.54 mL | 7.08 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
