Signaling Pathway
STING antagonist
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | H-151 is a highly potent, selective and covalent antagonist of STING, reduces TBK1 phosphorylation and suppresses human STING palmitoylation. |
|---|
| Catalog Num | A19676 |
|---|---|
| Formula | C17H17N3O |
| Molecular Weight | 279.34 |
| CAS Number | 941987-60-6 |
| SMILES | O=C(NC1=CNC2=C1C=CC=C2)NC3=CC=C(CC)C=C3 |
| Synonyms | H 151; H151 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (186.15 mM) | |
| Water | Insoluble | ||
| Ethanol | 13 mg/mL (46.53 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.8 mL | 178.99 mL | 357.99 mL |
| 0.5 mM | 7.16 mL | 35.8 mL | 71.6 mL |
| 1 mM | 3.58 mL | 17.9 mL | 35.8 mL |
| 5 mM | 0.72 mL | 3.58 mL | 7.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
