Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Halofuginone is a semisynthetic quinazolinone alkaloid anticoccidial derived from the plant Dichroa febrifuga, with antifibrotic and potential antineoplastic activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12441 |
|---|---|
| Formula | C16H17BrClN3O3 |
| Molecular Weight | 414.68 |
| CAS Number | 55837-20-2 |
| SMILES | C1C[C@H]([C@@H](NC1)CC(=O)CN2C=NC3=CC(=C(C=C3C2=O)Cl)Br)O |
| Synonyms | Tempostatin; RU 19110 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 17 mg/mL (40.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.11 mL | 120.57 mL | 241.15 mL |
| 0.5 mM | 4.82 mL | 24.11 mL | 48.23 mL |
| 1 mM | 2.41 mL | 12.06 mL | 24.11 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
