Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | HSP990 is an orally bioavailable inhibitor of human heat-shock protein 90 (Hsp90) with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12850 |
|---|---|
| Formula | C20H18FN5O2 |
| Molecular Weight | 379.39 |
| CAS Number | 934343-74-5 |
| SMILES | CC1=NC(=NC2=C1C(=O)N[C@H](C2)C3=C(C=C(C=C3)F)C4=NC(=CC=C4)OC)N |
| Synonyms | HSP990, HSP 990, NVP-HSP990 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (171.32 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.36 mL | 131.79 mL | 263.58 mL |
| 0.5 mM | 5.27 mL | 26.36 mL | 52.72 mL |
| 1 mM | 2.64 mL | 13.18 mL | 26.36 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
