Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | HTH-01-015 is a potent and selective inhibitor of NUAK1 (IC50 = 100 nM) and does not affect the activity of a panel of 139 other kinases, including additional AMPK family members. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16281 |
|---|---|
| Formula | C26H28N8O |
| Molecular Weight | 468.56 |
| CAS Number | 1613724-42-7 |
| SMILES | CC1=C(N(C)C(C2=CC(C=CC=C3)=C3C=C2N4C)=O)C4=NC(NC5=CN(N=C5)C6CCNCC6)=N1 |
| Synonyms | HTH01-015, HTH 01-015 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 54 mg/mL (115.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 28 mg/mL (59.75 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.34 mL | 106.71 mL | 213.42 mL |
| 0.5 mM | 4.27 mL | 21.34 mL | 42.68 mL |
| 1 mM | 2.13 mL | 10.67 mL | 21.34 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
