Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Hyodeoxycholic (HDCA) acid is a secondary bile acid, one of the metabolic byproducts of intestinal bacteria. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10460 |
|---|---|
| Formula | C24H40O4 |
| Molecular Weight | 392.6 |
| CAS Number | 83-49-8 |
| SMILES | C[C@H](CCC(=O)O)[C@@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@@H]([C@H]4[C@@]3(CC[C@H](C4)O)C)O)C |
| Synonyms | 3α,6α-Dihydroxy-5 β-cholan-24-oic acid, HDCA |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (168.12 mM) | |
| Water | Insoluble | ||
| Ethanol | 66 mg/mL (168.12 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.47 mL | 127.36 mL | 254.71 mL |
| 0.5 mM | 5.09 mL | 25.47 mL | 50.94 mL |
| 1 mM | 2.55 mL | 12.74 mL | 25.47 mL |
| 5 mM | 0.51 mL | 2.55 mL | 5.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
