Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ICG-001 is a specific inhibitor of Wnt/β-catenin signaling pathway that inhibits β-catenin/cyclic AMP response element-binding (CREB) protein transcription (IC50=3 microM) . | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11039 |
|---|---|
| Formula | C33H32N4O4 |
| Molecular Weight | 548.6 |
| CAS Number | 780757-88-2, 847591-62-2 |
| SMILES | C1CN([C@H]2CN(C(=O)[C@@H](N2C1=O)CC3=CC=C(C=C3)O)CC4=CC=CC5=CC=CC=C54)C(=O)NCC6=CC=CC=C6 |
| Synonyms | ICG001 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 99 mg/mL (180.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL | ||
| In vivo | 2% DMSO+50% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.23 mL | 91.14 mL | 182.28 mL |
| 0.5 mM | 3.65 mL | 18.23 mL | 36.46 mL |
| 1 mM | 1.82 mL | 9.11 mL | 18.23 mL |
| 5 mM | 0.36 mL | 1.82 mL | 3.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
