Loading distributor info...
| Description | INH14 is a cell permeable inhibitor of IKKα/IKKβ, with IC50s of 8.97 and 3.59 μM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19119 |
|---|---|
| Formula | C15H16N2O |
| Molecular Weight | 240.3 |
| CAS Number | 200134-22-1 |
| SMILES | O=C(NC1=CC=CC=C1)NC2=CC=C(CC)C=C2 |
| Synonyms | INH 14; INH-14 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (199.75 mM) | |
| Water | Insoluble | ||
| Ethanol | 18 mg/mL (74.9 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.61 mL | 208.07 mL | 416.15 mL |
| 0.5 mM | 8.32 mL | 41.61 mL | 83.23 mL |
| 1 mM | 4.16 mL | 20.81 mL | 41.61 mL |
| 5 mM | 0.83 mL | 4.16 mL | 8.32 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
