Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ipratropium bromide is a muscarinic antagonist, bronchodilator, N-Isopropyl salt of atropine. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10476 |
|---|---|
| Formula | C20H30BrNO3 |
| Molecular Weight | 412.37 |
| CAS Number | 22254-24-6 |
| SMILES | CC(C)[N+]1(C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3)C.[Br-] |
| Synonyms | Atrovent, Apovent, Aerovent |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (181.87 mM) | |
| Water | 75 mg/mL (181.87 mM) | ||
| Ethanol | 75 mg/mL (181.87 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.25 mL | 121.25 mL | 242.5 mL |
| 0.5 mM | 4.85 mL | 24.25 mL | 48.5 mL |
| 1 mM | 2.43 mL | 12.13 mL | 24.25 mL |
| 5 mM | 0.49 mL | 2.43 mL | 4.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
