Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Irbesartan is an angiotensin II receptor antagonist used mainly for the treatment of hypertension. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10477 |
|---|---|
| Formula | C25H28N6O |
| Molecular Weight | 428.5 |
| CAS Number | 138402-11-6 |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1CC3=CC=C(C=C3)C4=CC=CC=C4C5=NNN=N5 |
| Synonyms | BMS-186295, SR-47436, Aprovel, Karvea |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 3 mg/mL (7 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (7 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.34 mL | 116.69 mL | 233.37 mL |
| 0.5 mM | 4.67 mL | 23.34 mL | 46.67 mL |
| 1 mM | 2.33 mL | 11.67 mL | 23.34 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
