Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Isoconazole nitrate (Travogen) is an azole antifungal reagent. |
|---|
| Catalog Num | A10481 |
|---|---|
| Formula | C18H14Cl4N2O.HNO3 |
| Molecular Weight | 479.14 |
| CAS Number | 24168-96-5 |
| SMILES | C1=CC(=C(C(=C1)Cl)COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-] |
| Synonyms | Adestan G 100, Fazol, Gyno-Travogen, R 15454, Travogyn |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 41 mg/mL (85.56 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (8.34 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.87 mL | 104.35 mL | 208.71 mL |
| 0.5 mM | 4.17 mL | 20.87 mL | 41.74 mL |
| 1 mM | 2.09 mL | 10.44 mL | 20.87 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
