Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Istradefylline (KW-6002) is a selective antagonist at the A2A receptor. It has been found to be useful in the treatment of Parkinson's disease. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11451 |
|---|---|
| Formula | C20H24N4O4 |
| Molecular Weight | 384.4 |
| CAS Number | 155270-99-8 |
| SMILES | CCN1C2=C(C(=O)N(C1=O)CC)N(C(=N2)/C=C/C3=CC(=C(C=C3)OC)OC)C |
| Synonyms | KW-6002,KW6002 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 5 mg/mL (13 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.01 mL | 130.07 mL | 260.15 mL |
| 0.5 mM | 5.2 mL | 26.01 mL | 52.03 mL |
| 1 mM | 2.6 mL | 13.01 mL | 26.01 mL |
| 5 mM | 0.52 mL | 2.6 mL | 5.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
