Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JH-RE-06, a potent REV1-REV7 interface inhibitor (IC50=0.78 μM; Kd=0.42 μM), targets REV1 that interacts with the REV7 subunit of POLζ. |
|---|
| Catalog Num | A19168 |
|---|---|
| Formula | C20H16Cl3N3O4 |
| Molecular Weight | 468.72 |
| CAS Number | 1361227-90-8 |
| SMILES | O=C1C(C(CC(C)C)=O)=C(NC2=CC=C(Cl)C=C2Cl)NC3=C1C([N+]([O-])=O)=CC=C3Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (25.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.33 mL | 106.67 mL | 213.35 mL |
| 0.5 mM | 4.27 mL | 21.33 mL | 42.67 mL |
| 1 mM | 2.13 mL | 10.67 mL | 21.33 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
